| product Name |
1-amino-2-chloroanthraquinone |
| Synonyms |
9,10-Anthracenedione, 1-amino-2-chloro-; 1-Amino-2-chloroanthraquinone; 1-amino-2-chloroanthracene-9,10-dione |
| Molecular Formula |
C14H8ClNO2 |
| Molecular Weight |
257.6718 |
| InChI |
InChI=1/C14H8ClNO2/c15-10-6-5-9-11(12(10)16)14(18)8-4-2-1-3-7(8)13(9)17/h1-6H,16H2 |
| CAS Registry Number |
117-07-7 |
| EINECS |
204-170-9 |
| Molecular Structure |
|
| Density |
1.486g/cm3 |
| Boiling point |
498.1°C at 760 mmHg |
| Refractive index |
1.711 |
| Flash point |
255.1°C |
| Vapour Pressur |
4.66E-10mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|