| product Name |
1,3-dihydroxy-2-methylanthraquinone |
| Synonyms |
Rubiadin; 1,3-dihydroxy-2-methylanthracene-9,10-dione |
| Molecular Formula |
C15H10O4 |
| Molecular Weight |
254.2375 |
| InChI |
InChI=1/C15H10O4/c1-7-11(16)6-10-12(13(7)17)15(19)9-5-3-2-4-8(9)14(10)18/h2-6,16-17H,1H3 |
| CAS Registry Number |
117-02-2 |
| Molecular Structure |
|
| Density |
1.476g/cm3 |
| Boiling point |
527.1°C at 760 mmHg |
| Refractive index |
1.709 |
| Flash point |
286.6°C |
| Vapour Pressur |
1E-11mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|