| product Name |
[3,3'-bi-7H-benz[de]anthracene]-7,7'-dione |
| Synonyms |
(3,3'-Bi-7H-benz(de)anthracene)-7,7'-dione; 13,13'-Dibenzanthronyl; NSC 82340; 7H,7'H-3,3'-bibenzo[de]anthracene-7,7'-dione |
| Molecular Formula |
C34H18O2 |
| Molecular Weight |
458.5055 |
| InChI |
InChI=1/C34H18O2/c35-33-27-9-3-1-7-19(27)25-17-15-21(23-11-5-13-29(33)31(23)25)22-16-18-26-20-8-2-4-10-28(20)34(36)30-14-6-12-24(22)32(26)30/h1-18H |
| CAS Registry Number |
116-96-1 |
| EINECS |
204-166-7 |
| Molecular Structure |
|
| Density |
1.373g/cm3 |
| Boiling point |
710.2°C at 760 mmHg |
| Refractive index |
1.793 |
| Flash point |
251.9°C |
| Vapour Pressur |
5.12E-20mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|