| product Name |
1-(Hydroxymethyl)-5,5-dimethyl hydantoin |
| Synonyms |
1-(Hydroxymethyl)-5,5-dimethylhydantoin; 5,5-Dimethyl-1-(hydroxymethyl)hydantoin; 1-(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione |
| Molecular Formula |
C6H10N2O3 |
| Molecular Weight |
158.1552 |
| InChI |
InChI=1/C6H10N2O3/c1-6(2)4(10)7-5(11)8(6)3-9/h9H,3H2,1-2H3,(H,7,10,11) |
| CAS Registry Number |
116-25-6 |
| EINECS |
204-132-1 |
| Molecular Structure |
|
| Density |
1.257g/cm3 |
| Refractive index |
1.493 |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
