| product Name |
methylphenobarbital |
| Synonyms |
5-ethyl-1-methyl-5-phenylbarbituric acid; methylphenobarbitone; 5-ethyl-1-methyl-5-phenylpyrimidine-2,4,6(1H,3H,5H)-trione |
| Molecular Formula |
C13H14N2O3 |
| Molecular Weight |
246.2619 |
| InChI |
InChI=1/C13H14N2O3/c1-3-13(9-7-5-4-6-8-9)10(16)14-12(18)15(2)11(13)17/h4-8H,3H2,1-2H3,(H,14,16,18) |
| CAS Registry Number |
115-38-8 |
| EINECS |
204-085-7 |
| Molecular Structure |
|
| Density |
1.211g/cm3 |
| Boiling point |
395.9°C at 760 mmHg |
| Refractive index |
1.543 |
| Flash point |
193.2°C |
| Vapour Pressur |
5.62E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|