| product Name |
acetophenolisatin |
| Synonyms |
oxyphenisatine di(acetate); 4,4-(2-oxoindoline-3,3-diyl)diphenyl di(acetate); (2-oxo-2,3-dihydro-1H-indole-3,3-diyl)dibenzene-4,1-diyl diacetate |
| Molecular Formula |
C24H19NO5 |
| Molecular Weight |
401.4114 |
| InChI |
InChI=1/C24H19NO5/c1-15(26)29-19-11-7-17(8-12-19)24(18-9-13-20(14-10-18)30-16(2)27)21-5-3-4-6-22(21)25-23(24)28/h3-14H,1-2H3,(H,25,28) |
| CAS Registry Number |
115-33-3 |
| EINECS |
204-083-6 |
| Molecular Structure |
|
| Density |
1.282g/cm3 |
| Boiling point |
566.5°C at 760 mmHg |
| Refractive index |
1.611 |
| Flash point |
296.4°C |
| Vapour Pressur |
7.5E-13mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|