| product Name |
2-Methyl-3-buten-2-ol |
| Synonyms |
2-Hydroxy-2-methyl-3-butene; Dimethyl vinyl carbinol~3-Hydroxy-3-methyl-1-butene; 2-methylbut-3-en-2-ol; 3-methylbut-2-en-2-ol; pent-2-en-2-ol |
| Molecular Formula |
C5H10O |
| Molecular Weight |
86.1323 |
| InChI |
InChI=1/C5H10O/c1-3-4-5(2)6/h4,6H,3H2,1-2H3 |
| CAS Registry Number |
115-18-4 |
| EINECS |
204-068-4 |
| Molecular Structure |
|
| Density |
0.844g/cm3 |
| Melting point |
-43℃ |
| Boiling point |
114.1°C at 760 mmHg |
| Refractive index |
1.435 |
| Flash point |
32°C |
| Vapour Pressur |
10.3mmHg at 25°C |
| Hazard Symbols |
F++:Extremely flammable;
|
| Risk Codes |
R11:Highly flammable.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
|
|