| product Name |
(9Z)-octadec-9-enoate |
| Synonyms |
(9Z)-9-Octadecenoate; (Z)-Octadec-9-enoate; 9-octadecenoic acid, ion(1-), (9Z)-; cis-Octadec-9-enoate; cis-Oleate; Oleinate; Z-9-Octadecenoate |
| Molecular Formula |
C18H33O2 |
| Molecular Weight |
281.454 |
| InChI |
InChI=1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/p-1/b10-9- |
| CAS Registry Number |
115-06-0 |
| Molecular Structure |
|
| Boiling point |
360°C at 760 mmHg |
| Flash point |
270.1°C |
| Vapour Pressur |
3.7E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|