| product Name |
N-Methylnicotinamide |
| Synonyms |
Methylnicotinamide; N-methylpyridine-3-carboxamide |
| Molecular Formula |
C7H8N2O |
| Molecular Weight |
136.1512 |
| InChI |
InChI=1/C7H8N2O/c1-8-7(10)6-3-2-4-9-5-6/h2-5H,1H3,(H,8,10) |
| CAS Registry Number |
114-33-0 |
| EINECS |
204-046-4 |
| Molecular Structure |
|
| Density |
1.106g/cm3 |
| Melting point |
100-105℃ |
| Boiling point |
347.7°C at 760 mmHg |
| Refractive index |
1.529 |
| Flash point |
164.1°C |
| Vapour Pressur |
5.3E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
