product Name |
N-Methylnicotinamide |
Synonyms |
Methylnicotinamide; N-methylpyridine-3-carboxamide |
Molecular Formula |
C7H8N2O |
Molecular Weight |
136.1512 |
InChI |
InChI=1/C7H8N2O/c1-8-7(10)6-3-2-4-9-5-6/h2-5H,1H3,(H,8,10) |
CAS Registry Number |
114-33-0 |
EINECS |
204-046-4 |
Molecular Structure |
|
Density |
1.106g/cm3 |
Melting point |
100-105℃ |
Boiling point |
347.7°C at 760 mmHg |
Refractive index |
1.529 |
Flash point |
164.1°C |
Vapour Pressur |
5.3E-05mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|