| product Name |
1,1-dimethyl-4-phenyl-2,3,5,6-tetrahydropyrazine |
| Synonyms |
Piperazinium, 1,1-dimethyl-4-phenyl-; 1,1-Dimethyl-4-phenylpiperazinium; Dimethylphenylpiperazinium; 1,1-dimethyl-4-phenylpiperazin-1-ium |
| Molecular Formula |
C12H19N2 |
| Molecular Weight |
191.2921 |
| InChI |
InChI=1/C12H19N2/c1-14(2)10-8-13(9-11-14)12-6-4-3-5-7-12/h3-7H,8-11H2,1-2H3/q+1 |
| CAS Registry Number |
114-28-3 |
| Molecular Structure |
|
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|