| product Name |
Propoxur |
| Synonyms |
2-ISOPROPOXYPHENYL METHYLCARBAMATE; 2-(1-methylethoxy)phenol methylcarbamate; 2-(1-methylethoxy)phenyl methylcarbamate; o-Isopropoxyphenyl Methylcarbamate; o-isopropoxyphenyl N-methylcarbamate; aprocarb; BAY 39007; BAY 9010; Baygon; BAYGON [N-METHYL-2-ISOPROPOXYPHENYLCARBAMATE]; Blattanex; Blattosep; Bolfo; Chemagro 9010; DMS 33; IMPC; Invisi-gard; Isocarb; Isopropoxyphenyl methylcarbamate; Methyl-2-isopropoxyphenylcarbamate; Methylcarbamic acid, o-isopropoxyphenol ester; PHC; Phenol, o-isopropoxy-, methylcarbamate; Pillargon; Propotox; Propyon; Sendran; Suncide; Tendex; Tugon fliegenkugel; Unden; 2-(propan-2-yloxy)phenyl methylcarbamate |
| Molecular Formula |
C11H15NO3 |
| Molecular Weight |
209.2417 |
| InChI |
InChI=1/C11H15NO3/c1-8(2)14-9-6-4-5-7-10(9)15-11(13)12-3/h4-8H,1-3H3,(H,12,13) |
| CAS Registry Number |
114-26-1 |
| EINECS |
204-043-8 |
| Molecular Structure |
|
| Density |
1.082g/cm3 |
| Melting point |
91℃ |
| Boiling point |
295.4°C at 760 mmHg |
| Refractive index |
1.502 |
| Flash point |
132.5°C |
| Water solubility |
Slightly soluble. 0.2 g/100 mL |
| Vapour Pressur |
0.00153mmHg at 25°C |
| Hazard Symbols |
T:Toxic;
N:Dangerous for the environment;
|
| Risk Codes |
R25:;
R50/53:;
|
| Safety Description |
S37:;
S45:;
S60:;
S61:;
|
|