| product Name |
Sodium mandelate |
| Synonyms |
Mandelic acid sodium; sodium hydroxy(phenyl)acetate |
| Molecular Formula |
C8H7NaO3 |
| Molecular Weight |
174.1291 |
| InChI |
InChI=1/C8H8O3.Na/c9-7(8(10)11)6-4-2-1-3-5-6;/h1-5,7,9H,(H,10,11);/q;+1/p-1 |
| CAS Registry Number |
114-21-6 |
| EINECS |
204-041-7 |
| Molecular Structure |
|
| Boiling point |
321.8°C at 760 mmHg |
| Flash point |
162.6°C |
| Vapour Pressur |
0.00012mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|