| product Name |
MGK 264 |
| Synonyms |
N-(2-Ethylhexyl)-5-norbornene-2,3-dicarboximide; MGK 264 (TM); 2-(2-ethylhexyl)-3a,4,7,7a-tetrahydro-4,7-Methano-1H-isoindole-1,3(2H)-dione; Carboximide; MGK-264; N-Octylbicycloheptenedicarboximide; Octacide 264; Octyl bicycloheptene dicarboximide; Synergist 264; Van Dyk 264; Synergist MGK-264; 2-(2-ethylhexyl)-3a,4,7,7a-tetrahydro-1H-4,7-methanoisoindole-1,3(2H)-dione |
| Molecular Formula |
C17H25NO2 |
| Molecular Weight |
275.3859 |
| InChI |
InChI=1/C17H25NO2/c1-3-5-6-11(4-2)10-18-16(19)14-12-7-8-13(9-12)15(14)17(18)20/h7-8,11-15H,3-6,9-10H2,1-2H3 |
| CAS Registry Number |
113-48-4 |
| EINECS |
204-029-1 |
| Molecular Structure |
|
| Density |
1.085g/cm3 |
| Boiling point |
406.1°C at 760 mmHg |
| Refractive index |
1.527 |
| Flash point |
168.4°C |
| Vapour Pressur |
8.35E-07mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R21:;
|
| Safety Description |
S36/37:;
|
|