| product Name |
Oleic acid |
| Synonyms |
Metaupon; oleoate; red oil |
| Molecular Formula |
C18H34O2 |
| Molecular Weight |
282.46 |
| InChI |
InChI=1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9- |
| CAS Registry Number |
112-80-1 |
| EINECS |
204-007-1 |
| Molecular Structure |
|
| Density |
0.89 |
| Melting point |
13℃ |
| Boiling point |
360℃ |
| Refractive index |
1.4585-1.4605 |
| Flash point |
189℃ |
| Water solubility |
negligible |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S37/39:;
|
|