| product Name |
N,N-dimethylhexadecylamine |
| Synonyms |
N,N-Dimethyl-n-hexadecylamine; Hexadecyl dimethyl amine; N,N-Dimethylpalmitylamine; 1-(Dimethylamino)hexadecane; Dimethyl Hexadecyl Amine; DMA1697 |
| Molecular Formula |
C18H39N |
| Molecular Weight |
269.51 |
| InChI |
InChI=1/C18H39N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3/h4-18H2,1-3H3 |
| CAS Registry Number |
112-69-6;75444-69-8 |
| EINECS |
203-997-2 |
| Molecular Structure |
|
| Density |
0.801 |
| Refractive index |
1.444 |
| Hazard Symbols |
C:Corrosive;
|
| Risk Codes |
R34:;
|
| Safety Description |
S26:;
S36/37/39:;
S45:;
|
|