product Name |
Methyl stearate |
Synonyms |
Methyl n-octadecanoate; Stearic acid methyl ester; methyl octadecanoate |
Molecular Formula |
C19H38O2 |
Molecular Weight |
298.5038 |
InChI |
InChI=1/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
CAS Registry Number |
112-61-8 |
EINECS |
203-990-4 |
Molecular Structure |
|
Density |
0.863g/cm3 |
Melting point |
37-39℃ |
Boiling point |
355.5°C at 760 mmHg |
Refractive index |
1.444 |
Flash point |
169.3°C |
Vapour Pressur |
3.11E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|