| product Name |
isopropyl stearate |
| Synonyms |
Isopropyl stearate; 1-Methylethyl octadecanoate; Octadecanoic acid, 1-methylethyl ester; 4-02-00-01219 (Beilstein Handbook Reference); BRN 1791443; UNII-43253ZW1MZ; Wickenol 127; Stearic acid, isopropyl ester; propan-2-yl octadecanoate |
| Molecular Formula |
C21H42O2 |
| Molecular Weight |
326.557 |
| InChI |
InChI=1/C21H42O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(22)23-20(2)3/h20H,4-19H2,1-3H3 |
| CAS Registry Number |
112-10-7 |
| EINECS |
203-934-9 |
| Molecular Structure |
|
| Density |
0.861g/cm3 |
| Boiling point |
368.2°C at 760 mmHg |
| Refractive index |
1.445 |
| Flash point |
179.3°C |
| Vapour Pressur |
1.3E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|