| product Name |
3,5-Dimethylpyrazole-1-carboxamide |
| Synonyms |
1-Carboxamido-3,5-dimethylpyrazole; 3,5-Dimethyl-1H-pyrazole-1-carboxamide |
| Molecular Formula |
C6H9N3O |
| Molecular Weight |
139.1552 |
| InChI |
InChI=1/C6H9N3O/c1-4-3-5(2)9(8-4)6(7)10/h3H,1-2H3,(H2,7,10) |
| CAS Registry Number |
934-48-5 |
| EINECS |
213-283-2 |
| Molecular Structure |
|
| Density |
1.28g/cm3 |
| Melting point |
110-113℃ |
| Boiling point |
296.8°C at 760 mmHg |
| Refractive index |
1.6 |
| Flash point |
133.3°C |
| Vapour Pressur |
0.0014mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
