| product Name |
Methyl Laurate |
| Synonyms |
Methyl dodecanoate |
| Molecular Formula |
C13H26O2 |
| Molecular Weight |
214.3443 |
| InChI |
InChI=1/C13H26O2/c1-3-4-5-6-7-8-9-10-11-12-13(14)15-2/h3-12H2,1-2H3 |
| CAS Registry Number |
111-82-0 |
| EINECS |
203-911-3 |
| Molecular Structure |
|
| Density |
0.869g/cm3 |
| Melting point |
5.2℃ |
| Boiling point |
263°C at 760 mmHg |
| Refractive index |
1.432 |
| Flash point |
114.6°C |
| Vapour Pressur |
0.0105mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|