| product Name |
Ethyl stearate |
| Synonyms |
203-887-4; Ethyl Stearate; octadecanoic acid, ethyl ester; ethyl octadecanoate |
| Molecular Formula |
C20H40O2 |
| Molecular Weight |
312.5304 |
| InChI |
InChI=1/C20H40O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h3-19H2,1-2H3 |
| CAS Registry Number |
111-61-5 |
| EINECS |
203-887-4 |
| Molecular Structure |
|
| Density |
0.862g/cm3 |
| Boiling point |
356°C at 760 mmHg |
| Refractive index |
1.445 |
| Flash point |
161°C |
| Vapour Pressur |
3.01E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|