| product Name |
N-(2-hydroxyethyl)stearamide |
| Synonyms |
N-(2-Hydroxyethyl)octadecanamide; Monoethanolamine stearic acid amide; N-Stearoylethanolamine; Octadecanamide, N-(2-hydroxyethyl)-; Stearamide MEA; Stearic acid monoethanolamide; Stearoyl monoethanolamide; Clindrol 200-MS; Comperlan HS; Cycloamide SM; Loramine S 280; Marlamid M 18; N-(Hydroxyethyl)stearamide; NSC 3377; Onyx Wax EL; Stearamyl; Stearic ethanolamide; Stearic ethylolamide; Stearic monoethanolamide; Stearic monoethanolamine; Stearoylethanolamine; Stearoylmonoethanolamide |
| Molecular Formula |
C20H41NO2 |
| Molecular Weight |
327.545 |
| InChI |
InChI=1/C20H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)21-18-19-22/h22H,2-19H2,1H3,(H,21,23) |
| CAS Registry Number |
111-57-9 |
| EINECS |
203-883-2 |
| Molecular Structure |
|
| Density |
0.904g/cm3 |
| Boiling point |
486°C at 760 mmHg |
| Refractive index |
1.463 |
| Flash point |
247.7°C |
| Vapour Pressur |
1.74E-11mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|