| product Name |
Ethylene glycol diacetate |
| Synonyms |
Ethanediol diacetate; Ethylene diacetate; 1,2-Diacetoxyethane; Ethylene Acetate; ethane-1,2-diyl diacetate; ethane-1,2-diyl diacetate - ethane-1,2-diol (1:1); 2-acetoxyethyl acetate; 1-acetoxyethyl acetate |
| Molecular Formula |
C6H10O4 |
| Molecular Weight |
146.1412 |
| InChI |
InChI=1/C6H10O4/c1-4(7)9-6(3)10-5(2)8/h6H,1-3H3 |
| CAS Registry Number |
111-55-7 |
| EINECS |
203-881-1 |
| Molecular Structure |
|
| Density |
1.083g/cm3 |
| Melting point |
-41℃ |
| Boiling point |
168°C at 760 mmHg |
| Refractive index |
1.408 |
| Flash point |
78.2°C |
| Water solubility |
160 g/L (20℃) |
| Vapour Pressur |
1.65mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S36:;
|
|