product Name |
Triethyleneglycoldiacetate |
Synonyms |
Triethylene glycol diacetate; ethane-1,2-diylbis(oxyethane-2,1-diyl) diacetate |
Molecular Formula |
C10H18O6 |
Molecular Weight |
234.2463 |
InChI |
InChI=1/C10H18O6/c1-9(11)15-7-5-13-3-4-14-6-8-16-10(2)12/h3-8H2,1-2H3 |
CAS Registry Number |
111-21-7 |
EINECS |
203-846-0 |
Molecular Structure |
|
Density |
1.098g/cm3 |
Boiling point |
286°C at 760 mmHg |
Refractive index |
1.432 |
Flash point |
125.2°C |
Vapour Pressur |
0.00271mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|