| product Name |
Pimelic acid |
| Synonyms |
1,5-Pentanedicarboxylic acid; Heptanedioic acid; Pentane-1,5-dicarboxylic acid; Heptanedioic-2,2,6,6-d4 acid (Pimelic acid); heptanedioate |
| Molecular Formula |
C7H10O4 |
| Molecular Weight |
158.153 |
| InChI |
InChI=1/C7H12O4/c8-6(9)4-2-1-3-5-7(10)11/h1-5H2,(H,8,9)(H,10,11)/p-2 |
| CAS Registry Number |
111-16-0 |
| EINECS |
203-840-8 |
| Molecular Structure |
|
| Melting point |
103-106℃ |
| Boiling point |
353.7°C at 760 mmHg |
| Flash point |
181.9°C |
| Water solubility |
25 g/L (13℃) |
| Vapour Pressur |
5.92E-06mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S36:;
|
|