| product Name |
Methyl caprylate |
| Synonyms |
Methyl n-octanoate; Methyl Octanoate |
| Molecular Formula |
C9H18O2 |
| Molecular Weight |
158.24 |
| InChI |
InChI=1/C9H18O2/c1-3-4-5-6-7-8-9(10)11-2/h3-8H2,1-2H3 |
| CAS Registry Number |
111-11-5 |
| EINECS |
203-835-0 |
| Molecular Structure |
|
| Density |
0.878 |
| Boiling point |
194-195℃ |
| Refractive index |
1.4165-1.4185 |
| Flash point |
73℃ |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:;
|
|