| product Name |
Isoamyl formate |
| Synonyms |
1-Butanol, 3-methyl-, formate; isopentyl formate; Natural Isoamyl Formate; 3-methylbutyl formate |
| Molecular Formula |
C6H12O2 |
| Molecular Weight |
116.1583 |
| InChI |
InChI=1/C6H12O2/c1-6(2)3-4-8-5-7/h5-6H,3-4H2,1-2H3 |
| CAS Registry Number |
110-45-2 |
| EINECS |
203-769-2 |
| Molecular Structure |
|
| Density |
0.882g/cm3 |
| Melting point |
-93℃ |
| Boiling point |
126°C at 760 mmHg |
| Refractive index |
1.397 |
| Flash point |
22.3°C |
| Vapour Pressur |
11.9mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R10:;
R36/37:;
|
| Safety Description |
S2:;
S24:;
|
|