| product Name |
N,N,N',N'-Tetramethylethylenediamine |
| Synonyms |
TMEDA; temed electrophoresis; N,N,N',N'-Tetramethyl-1,2-ethanediamine; 1,2-Bis-(dimethylamino)ethane; 1,2-Ethanediamine, N,N,N',N'-tetramethyl-; AI3-26631; CCRIS 4870; Dimethyl(2-(dimethylamino)ethyl)amine; EINECS 203-744-6; Ethylenediamine, N,N,N',N'-tetramethyl-; HSDB 5396; N,N,N',N'-Tetramethyl-1,2-diaminoethane; N,N,N',N'-Tetramethylethanediamine; Propamine D; Temed; Tetrameen; Tetramethyl ethylene diamine; Tetramethyldiaminoethane; Tetramethylethylenediamine; 1,2-Ethanediamine, N1,N1,N2,N2-tetramethyl-; 1,2-Bis(dimethylamino)ethane; 1,2-Di-(dimethylamino)ethane; 1,2-Di-(dimethylamino)ethane [UN2372] [Flammable liquid]; UN2372; N,N,N',N'-tetramethylethane-1,2-diamine; N,N,N',N'-tetramethylethane-1,2-diaminium |
| Molecular Formula |
C6H18N2 |
| Molecular Weight |
118.2194 |
| InChI |
InChI=1/C6H16N2/c1-7(2)5-6-8(3)4/h5-6H2,1-4H3/p+2 |
| CAS Registry Number |
110-18-9 |
| EINECS |
203-744-6 |
| Molecular Structure |
|
| Melting point |
-55℃ |
| Boiling point |
121°C at 760 mmHg |
| Flash point |
10°C |
| Water solubility |
miscible |
| Vapour Pressur |
14.9mmHg at 25°C |
| Hazard Symbols |
F:Flammable;
C:Corrosive;
|
| Risk Codes |
R11:;
R20/22:;
R34:;
|
| Safety Description |
S16:;
S26:;
S36/37/39:;
S45:;
|
|