| product Name |
Maleic acid |
| Synonyms |
cis-2-Butenedioic acid; (2Z)-but-2-enedioic acid; methylidenepropanedioic acid; (2E)-but-2-enedioic acid; Cis-Butenedioic acid |
| Molecular Formula |
C4H4O4 |
| Molecular Weight |
116.0722 |
| InChI |
InChI=1/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+ |
| CAS Registry Number |
110-16-7 |
| EINECS |
203-742-5 |
| Molecular Structure |
|
| Density |
1.499g/cm3 |
| Melting point |
134-138℃ |
| Boiling point |
355.482°C at 760 mmHg |
| Refractive index |
1.526 |
| Flash point |
182.981°C |
| Water solubility |
790 g/L (25℃) |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
R36/37/38:;
|
| Safety Description |
S26:;
S28A:;
S37:;
|
|