| product Name |
Acetonylacetone |
| Synonyms |
2,5-Hexanedione; Hexan-2,5-Dion; hexane-2,5-dione |
| Molecular Formula |
C6H10O2 |
| Molecular Weight |
114.1424 |
| InChI |
InChI=1/C6H10O2/c1-5(7)3-4-6(2)8/h3-4H2,1-2H3 |
| CAS Registry Number |
110-13-4 |
| EINECS |
203-738-3 |
| Molecular Structure |
|
| Density |
0.936g/cm3 |
| Melting point |
-6℃ |
| Boiling point |
188.8°C at 760 mmHg |
| Refractive index |
1.405 |
| Flash point |
78.9°C |
| Water solubility |
miscible |
| Vapour Pressur |
0.587mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S37/39:;
|
|