| product Name |
1-Pentene |
| Synonyms |
1-Pentylene; HSDB 1086; Propylethylene; alpha-Amylene; alpha-n-Amylene; pent-1-ene; 2-methylbut-2-ene |
| Molecular Formula |
C5H10 |
| Molecular Weight |
70.1329 |
| InChI |
InChI=1/C5H10/c1-4-5(2)3/h4H,1-3H3 |
| CAS Registry Number |
109-67-1 |
| EINECS |
203-694-5 |
| Molecular Structure |
|
| Density |
0.671g/cm3 |
| Melting point |
-165℃ |
| Boiling point |
36°C at 760 mmHg |
| Refractive index |
1.396 |
| Water solubility |
0.15 g/L (20℃) |
| Vapour Pressur |
511mmHg at 25°C |
| Hazard Symbols |
F+:Highly flammable;
Xn:Harmful;
|
| Risk Codes |
R12:;
R65:;
|
| Safety Description |
S16:;
|
|