| product Name |
3-Methoxycatechol |
| Synonyms |
Pyrogallol monomethyl ether; pyrogallol-1-methyl ether; 2,3-Dihydroxyanisole~Pyrogallol 1-methyl ether; 3-methoxybenzene-1,2-diol |
| Molecular Formula |
C7H8O3 |
| Molecular Weight |
140.1366 |
| InChI |
InChI=1/C7H8O3/c1-10-6-4-2-3-5(8)7(6)9/h2-4,8-9H,1H3 |
| CAS Registry Number |
934-00-9 |
| EINECS |
213-276-4 |
| Molecular Structure |
|
| Density |
1.27g/cm3 |
| Melting point |
39-43℃ |
| Boiling point |
268.1°C at 760 mmHg |
| Refractive index |
1.579 |
| Flash point |
119.5°C |
| Vapour Pressur |
0.00476mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
