| product Name |
1,3-Dibromopropane |
| Synonyms |
Trimethylene bromide; Trimethylene dibromide; 1,3-Dibromoproane; dibutyl benzene-1,2-dicarboxylate |
| Molecular Formula |
C3H6Br2 |
| Molecular Weight |
201.88864 |
| InChI |
InChI=1/C3H6Br2/c1-3-5-11-19-15(17)13-9-7-8-10-14(13)16(18)20-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3 |
| CAS Registry Number |
109-64-8 |
| EINECS |
203-690-3 |
| Molecular Structure |
|
| Density |
1.053g/cm3 |
| Melting point |
-34℃ |
| Boiling point |
336.989°C at 760 mmHg |
| Refractive index |
1.499 |
| Flash point |
177.43°C |
| Water solubility |
1.7 g/L (30℃) |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R10:;
R36/37/38:;
|
| Safety Description |
S16:;
S24/25:;
|
|