| product Name |
(acetato-O)ethylmercury |
| Synonyms |
Ethylmercury acetate; (Acetato-O)ethylmercury; Caswell No. 447A; EPA Pesticide Chemical Code 041502; Ethylmercuric acetate; Ethylmercury acetate (6CI); Ethylmerkuriacetat; Ethylmerkuriacetat [Czech]; Mercury, (acetato)ethyl-; Mercury, (acetato-kappaO)ethyl-; Mercury, acetyloxyethyl- (7CI); ethylmercury(1+) acetate |
| Molecular Formula |
C4H8HgO2 |
| Molecular Weight |
288.6951 |
| InChI |
InChI=1/C2H4O2.C2H5.Hg/c1-2(3)4;1-2;/h1H3,(H,3,4);1H2,2H3;/q;;+1/p-1/rC2H5Hg.C2H4O2/c1-2-3;1-2(3)4/h2H2,1H3;1H3,(H,3,4)/q+1;/p-1 |
| CAS Registry Number |
109-62-6 |
| EINECS |
203-688-2 |
| Molecular Structure |
|
| Boiling point |
117.1°C at 760 mmHg |
| Flash point |
40°C |
| Vapour Pressur |
13.9mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|