| product Name |
3-chloropropyl(dimethyl)amine |
| Synonyms |
3-Chloro-1-(N,N-dimethyl)propanamine; dimethylaminopropylchloride; AURORA KA-7644; 3-CHLORO-1-(N,N-DIMETHYL)PROPYLAMINE; N-(3-Chloropropyl)-dimethylamine; 3-chloro-N,N-dimethylpropan-1-amine; 3-chloro-N,N-dimethylpropan-1-amine |
| Molecular Formula |
C5H13Cl2N |
| Molecular Weight |
158.0694 |
| InChI |
InChI=1/C5H12ClN.ClH/c1-7(2)5-3-4-6;/h3-5H2,1-2H3;1H |
| CAS Registry Number |
109-54-6 |
| EINECS |
203-679-3 |
| Molecular Structure |
|
| Boiling point |
130.7°C at 760 mmHg |
| Flash point |
32.8°C |
| Vapour Pressur |
9.61mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|