| product Name |
2-butoxyethyl laurate |
| Synonyms |
Dodecanoic acid, 2-butoxyethyl ester; 2-Butoxyethyl laurate; Ethylene glycol monobutyl ether laurate; NSC 51643; Lauric acid, 2-butoxyethyl ester (8CI); 2-butoxyethyl dodecanoate |
| Molecular Formula |
C18H36O3 |
| Molecular Weight |
300.4766 |
| InChI |
InChI=1/C18H36O3/c1-3-5-7-8-9-10-11-12-13-14-18(19)21-17-16-20-15-6-4-2/h3-17H2,1-2H3 |
| CAS Registry Number |
109-37-5 |
| EINECS |
203-667-8 |
| Molecular Structure |
|
| Density |
0.895g/cm3 |
| Boiling point |
379.8°C at 760 mmHg |
| Refractive index |
1.443 |
| Flash point |
136°C |
| Vapour Pressur |
5.71E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|