| product Name |
2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]et hoxy]ethoxy]ethoxy]ethyl (Z)-octadec-9-enoate |
| Synonyms |
26-hydroxy-3,6,9,12,15,18,21,24-octaoxahexacos-1-yl (9Z)-octadec-9-enoate |
| Molecular Formula |
C36H70O11 |
| Molecular Weight |
678.9344 |
| InChI |
InChI=1/C36H70O11/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-36(38)47-35-34-46-33-32-45-31-30-44-29-28-43-27-26-42-25-24-41-23-22-40-21-20-39-19-18-37/h9-10,37H,2-8,11-35H2,1H3/b10-9- |
| CAS Registry Number |
109-33-1 |
| Molecular Structure |
|
| Density |
1.015g/cm3 |
| Boiling point |
689.9°C at 760 mmHg |
| Refractive index |
1.469 |
| Flash point |
193.3°C |
| Vapour Pressur |
5.01E-22mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|