| product Name |
butyl isovalerate |
| Synonyms |
Butyl isovalerate FCC; butyl 3-methylbutanoate |
| Molecular Formula |
C9H18O2 |
| Molecular Weight |
158.238 |
| InChI |
InChI=1/C9H18O2/c1-4-5-6-11-9(10)7-8(2)3/h8H,4-7H2,1-3H3 |
| CAS Registry Number |
109-19-3 |
| EINECS |
203-654-7 |
| Molecular Structure |
|
| Density |
0.874g/cm3 |
| Boiling point |
176.5°C at 760 mmHg |
| Refractive index |
1.416 |
| Flash point |
59.4°C |
| Vapour Pressur |
1.09mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S26:;
S36:;
|
|