product Name |
3-Hydroxypicolinamide |
Synonyms |
Hydroxypicolinamide; 3-Hydroxypyridine-2-carboxamide |
Molecular Formula |
C6H6N2O2 |
Molecular Weight |
138.124 |
InChI |
InChI=1/C6H6N2O2/c7-6(10)5-4(9)2-1-3-8-5/h1-3,9H,(H2,7,10) |
CAS Registry Number |
933-90-4 |
EINECS |
213-274-3 |
Molecular Structure |
|
Density |
1.384g/cm3 |
Melting point |
192-196℃ |
Boiling point |
479.3°C at 760 mmHg |
Refractive index |
1.622 |
Flash point |
243.7°C |
Vapour Pressur |
8.24E-10mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|