| product Name |
3-Hydroxypicolinamide |
| Synonyms |
Hydroxypicolinamide; 3-Hydroxypyridine-2-carboxamide |
| Molecular Formula |
C6H6N2O2 |
| Molecular Weight |
138.124 |
| InChI |
InChI=1/C6H6N2O2/c7-6(10)5-4(9)2-1-3-8-5/h1-3,9H,(H2,7,10) |
| CAS Registry Number |
933-90-4 |
| EINECS |
213-274-3 |
| Molecular Structure |
|
| Density |
1.384g/cm3 |
| Melting point |
192-196℃ |
| Boiling point |
479.3°C at 760 mmHg |
| Refractive index |
1.622 |
| Flash point |
243.7°C |
| Vapour Pressur |
8.24E-10mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
|
|
