| product Name |
1,3-dimethylbutyl acetate |
| Synonyms |
Acetic acid 4-methyl-2-pentyl ester; 4-methylpentan-2-yl acetate; hexan-2-yl acetate |
| Molecular Formula |
C8H16O2 |
| Molecular Weight |
144.2114 |
| InChI |
InChI=1/C8H16O2/c1-4-5-6-7(2)10-8(3)9/h7H,4-6H2,1-3H3 |
| CAS Registry Number |
108-84-9 |
| EINECS |
203-621-7 |
| Molecular Structure |
|
| Density |
0.876g/cm3 |
| Boiling point |
156.3°C at 760 mmHg |
| Refractive index |
1.411 |
| Flash point |
46.7°C |
| Vapour Pressur |
2.91mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|