| product Name |
Cyanuric chloride |
| Synonyms |
2,4,6-Trichloro-1,3,5-triazine; Cyanuricchloride,98%; TCT; 2,4,6-trichloro-1,2-dihydro-1,2,3-triazine |
| Molecular Formula |
C3H2Cl3N3 |
| Molecular Weight |
186.4271 |
| InChI |
InChI=1/C3H2Cl3N3/c4-2-1-3(5)8-9(6)7-2/h1,7H |
| CAS Registry Number |
108-77-0 |
| EINECS |
203-614-9 |
| Molecular Structure |
|
| Density |
1.86g/cm3 |
| Melting point |
145-148℃ |
| Boiling point |
209.523°C at 760 mmHg |
| Refractive index |
1.676 |
| Flash point |
80.517°C |
| Water solubility |
reacts |
| Vapour Pressur |
0.202mmHg at 25°C |
| Hazard Symbols |
T+:Very toxic;
C:Corrosive;
|
| Risk Codes |
R14:;
R22:;
R26:;
R34:;
R43:;
|
| Safety Description |
S26:;
S28A:;
S36/37/39:;
S45:;
S46:;
|
|