| product Name |
Dicapryl Adipate |
| Synonyms |
Bis(1-methylheptyl) adipate; NSC 6197; Adipic acid, bis(1-methylheptyl) ester (8CI); Hexanedioic acid, 1,6-bis(1-methylheptyl) ester; Hexanedioic acid, bis(1-methylheptyl) ester; Adipic acid, bis(1-methylheptyl) ester; dioctan-2-yl hexanedioate |
| Molecular Formula |
C2H2Cl2O2 |
| Molecular Weight |
128.9421 |
| InChI |
InChI=1/C2H2Cl2O2/c3-1(4)2(5)6/h1H,(H,5,6) |
| CAS Registry Number |
108-63-4 |
| EINECS |
203-601-8 |
| Molecular Structure |
|
| Density |
1.626g/cm3 |
| Boiling point |
193.999°C at 760 mmHg |
| Refractive index |
1.48 |
| Flash point |
75.552°C |
| Vapour Pressur |
0.196mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|