| product Name |
m-phenylene di(acetate) |
| Synonyms |
1,3-Diacetoxybenzene; benzene-1,3-diyl diacetate |
| Molecular Formula |
C10H10O4 |
| Molecular Weight |
194.184 |
| InChI |
InChI=1/C10H10O4/c1-7(11)13-9-4-3-5-10(6-9)14-8(2)12/h3-6H,1-2H3 |
| CAS Registry Number |
108-58-7 |
| EINECS |
203-596-2 |
| Molecular Structure |
|
| Density |
1.179g/cm3 |
| Boiling point |
278.6°C at 760 mmHg |
| Refractive index |
1.506 |
| Flash point |
136.2°C |
| Water solubility |
HYDROLYSIS |
| Vapour Pressur |
0.00422mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:;
|
| Safety Description |
S24/25:;
|
|