| product Name |
isocytosine |
| Synonyms |
2-amino-4-hydroxypyrimidine; 2-aminopyrimidin-4(3H)-one |
| Molecular Formula |
C4H5N3O |
| Molecular Weight |
111.102 |
| InChI |
InChI=1/C4H5N3O/c5-4-6-2-1-3(8)7-4/h1-2H,(H3,5,6,7,8) |
| CAS Registry Number |
108-53-2 |
| EINECS |
203-592-0 |
| Molecular Structure |
|
| Density |
1.55g/cm3 |
| Boiling point |
252.7°C at 760 mmHg |
| Refractive index |
1.688 |
| Flash point |
106.7°C |
| Vapour Pressur |
0.019mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
R36:;
|
| Safety Description |
S26:;
|
|