| product Name |
2,6-Dimethylpyrazine |
| Synonyms |
2,6-Dimethyl pyrazine |
| Molecular Formula |
C6H8N2 |
| Molecular Weight |
108.1411 |
| InChI |
InChI=1/C6H8N2/c1-5-3-7-4-6(2)8-5/h3-4H,1-2H3 |
| CAS Registry Number |
108-50-9 |
| EINECS |
203-589-4 |
| Molecular Structure |
|
| Density |
0.997g/cm3 |
| Melting point |
34-40℃ |
| Boiling point |
155.6°C at 760 mmHg |
| Refractive index |
1.503 |
| Flash point |
52.8°C |
| Vapour Pressur |
3.87mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R10:;
R22:;
|
| Safety Description |
S16:;
|
|