| product Name |
Resorcinol |
| Synonyms |
C.I. 76505; C.I. Developer 4; C.I. Oxidation Base 31; 1,3-benzenediol; 1,3-dihydroxybenzene; resorcine; 1,3-dihydroxybenzol; 3-hydroxycyclohexadien-1-one; 3-hydroxyphenol; alpha-resorcinol; benzene, 1,3-dihydroxy-; benzene, m-dihydroxy-; benzene-1,3-diol; c.i.76505; c.i.developer4; c.i.oxidationbase31; resorcin; m-dihydroxybenzene; 1,3-dihydroxy benzene |
| Molecular Formula |
C6H6O2 |
| Molecular Weight |
110.1106 |
| InChI |
InChI=1/C6H6O2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H |
| CAS Registry Number |
108-46-3 |
| EINECS |
203-585-2 |
| Molecular Structure |
|
| Density |
1.275g/cm3 |
| Melting point |
109-111℃ |
| Boiling point |
280°C at 760 mmHg |
| Refractive index |
1.612 |
| Flash point |
131.9°C |
| Water solubility |
140 g/100 mL |
| Vapour Pressur |
0.00229mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
N:Dangerous for the environment;
|
| Risk Codes |
R22:;
R36/38:;
R50:;
|
| Safety Description |
S26:;
S61:;
|
|