| product Name |
4,5-Dichloro-2-methylpyridazin-3-one |
| Synonyms |
3(2H)-Pyridazinone, 4,5-dichloro-2-methyl-; 4,5-Dichloro-2-methyl-3(2H)-pyridazinone; 5-24-02-00023 (Beilstein Handbook Reference); BRN 0127609; 4,5-dichloro-2-methylpyridazin-3(2H)-one |
| Molecular Formula |
C5H4Cl2N2O |
| Molecular Weight |
179.0041 |
| InChI |
InChI=1/C5H4Cl2N2O/c1-9-5(10)4(7)3(6)2-8-9/h2H,1H3 |
| CAS Registry Number |
933-76-6 |
| Molecular Structure |
|
| Density |
1.55g/cm3 |
| Boiling point |
197.2°C at 760 mmHg |
| Refractive index |
1.611 |
| Flash point |
73.1°C |
| Vapour Pressur |
0.382mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
