| product Name |
Isovaleryl chloride |
| Synonyms |
Isopentanoyl chloride~3-Methylbutyryl chloride; Butanoyl chloride, 3-methyl-; ; 3-methylbutanoyl chloride |
| Molecular Formula |
C5H9ClO |
| Molecular Weight |
120.5774 |
| InChI |
InChI=1/C5H9ClO/c1-4(2)3-5(6)7/h4H,3H2,1-2H3 |
| CAS Registry Number |
108-12-3 |
| EINECS |
203-552-2 |
| Molecular Structure |
|
| Density |
1.005g/cm3 |
| Boiling point |
116.4°C at 760 mmHg |
| Refractive index |
1.415 |
| Flash point |
25.5°C |
| Water solubility |
decomposes |
| Vapour Pressur |
18.2mmHg at 25°C |
| Hazard Symbols |
F:Flammable;
C:Corrosive;
|
| Risk Codes |
R11:;
R34:;
|
| Safety Description |
S16:;
S23:;
S9:;
|
|