| product Name |
Vinyl acetate |
| Synonyms |
Acetic acid vinyl ester; ethenyl acetate |
| Molecular Formula |
C4H6O2 |
| Molecular Weight |
86.0892 |
| InChI |
InChI=1/C4H6O2/c1-3-6-4(2)5/h3H,1H2,2H3 |
| CAS Registry Number |
108-05-4 |
| EINECS |
203-545-4 |
| Molecular Structure |
|
| Density |
0.924g/cm3 |
| Melting point |
-93℃ |
| Boiling point |
72.5°C at 760 mmHg |
| Refractive index |
1.39 |
| Water solubility |
23 g/L (20℃) |
| Vapour Pressur |
118mmHg at 25°C |
| Hazard Symbols |
F:Flammable;
|
| Risk Codes |
R11:;
|
| Safety Description |
S16:;
S23:;
S29:;
S33:;
|
|