| product Name |
3-Mercaptopropionic acid |
| Synonyms |
3-Mercaptopropanoic Acid; Thiopropionic acid; Mercapto Propionic Acid; 3-sulfanylpropanoic acid; 3-sulfanylpropanoate |
| Molecular Formula |
C3H5O2S |
| Molecular Weight |
105.1361 |
| InChI |
InChI=1/C3H6O2S/c4-3(5)1-2-6/h6H,1-2H2,(H,4,5)/p-1 |
| CAS Registry Number |
107-96-0 |
| EINECS |
203-537-0 |
| Molecular Structure |
|
| Melting point |
17-19℃ |
| Boiling point |
217.4°C at 760 mmHg |
| Flash point |
100.7°C |
| Water solubility |
soluble |
| Vapour Pressur |
0.0509mmHg at 25°C |
| Hazard Symbols |
T:Toxic;
|
| Risk Codes |
R23/24/25:;
R34:;
|
| Safety Description |
S26:;
S36/37/39:;
S45:;
|
|