| product Name |
Isoamylamine |
| Synonyms |
3-Methyl-1-butanamine; Isopentylamine~3-Methylbutylamine; 1-amino-3-methylbutane; Isopentylamine; 3-Methylbutylamine; 3-methylbutan-1-amine; 3-methylbutan-1-amine hydrochloride (1:1); 3-methylbutan-1-aminium |
| Molecular Formula |
C5H14N |
| Molecular Weight |
88.1708 |
| InChI |
InChI=1/C5H13N/c1-5(2)3-4-6/h5H,3-4,6H2,1-2H3/p+1 |
| CAS Registry Number |
107-85-7 |
| EINECS |
203-526-0 |
| Molecular Structure |
|
| Melting point |
-60℃ |
| Boiling point |
92.7°C at 760 mmHg |
| Flash point |
18.3°C |
| Vapour Pressur |
51.1mmHg at 25°C |
| Hazard Symbols |
 F:Highly flammable;
 C:Corrosive;
|
| Risk Codes |
R11:Highly flammable.;
R34:Causes burns.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
